PDB ligand accession: LUT
DrugBank: DB00137
PubChem:
ChEMBL: n/a
InChI Key: KBPHJBAIARWVSC-NSIPBSJQSA-N
SMILES: CC1=C(C(CC(C1)O)(C)C)C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC2C(=CC(CC2(C)C)O)C)C)C
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Prenol lipids
- Subclass: Tetraterpenoids
- Class: Prenol lipids
- Superclass: Lipids and lipid-like molecules
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | B6T892_LUT | B6T892 | Chlorophyll a-b binding | n/a | |
2 | A0A2D0TCJ0_LUT | A0A2D0TCJ0 | Chlorophyll a-b binding | n/a | |
3 | A0A7S3VRZ8_LUT | A0A7S3VRZ8 | Chlorophyll a-b binding | n/a | |
4 | P05310_LUT | P05310 | Photosystem I P700 | n/a | |
5 | D5MAL3_LUT | D5MAL3 | Photosystem I reaction | n/a | |
6 | Q75VY9_LUT | Q75VY9 | Chlorophyll a-b binding | n/a | |
7 | A0A3G1AUL2_LUT | A0A3G1AUL2 | Photosystem I P700 | n/a | |
8 | A0A6S8N9J6_LUT | A0A6S8N9J6 | Chlorophyll a-b binding | n/a | |
9 | Q32904_LUT | Q32904 | Chlorophyll a-b binding | n/a | |
10 | P12355_LUT | P12355 | Photosystem I reaction | n/a | |
11 | B6SUC4_LUT | B6SUC4 | Chlorophyll a-b binding | n/a | |
12 | A0A0K9QUQ7_LUT | A0A0K9QUQ7 | deleted | n/a | |
13 | A9NKM0_LUT | A9NKM0 | Chlorophyll a-b binding | n/a | |
14 | A0A0F6NFW5_LUT | A0A0F6NFW5 | Photosystem I P700 | n/a | |
15 | Q93WD2_LUT | Q93WD2 | Chlorophyll a-b binding | n/a | |
16 | A8IKC8_LUT | A8IKC8 | Chlorophyll a-b binding | n/a | |
17 | A0A2K1KGQ2_LUT | A0A2K1KGQ2 | Chlorophyll a-b binding | n/a | |
18 | Q9SQL2_LUT | Q9SQL2 | Chlorophyll a-b binding | n/a | |
19 | P27521_LUT | P27521 | Chlorophyll a-b binding | n/a | |
20 | A0A2P6TPR7_LUT | A0A2P6TPR7 | Chlorophyll a-b binding | n/a | |
21 | Q84Y02_LUT | Q84Y02 | Chlorophyll a-b binding | n/a | |
22 | A8ITV3_LUT | A8ITV3 | Chlorophyll a-b binding | n/a | |
23 | B6SSN3_LUT | B6SSN3 | Chlorophyll a-b binding | n/a | |
24 | A0A2K1JLZ3_LUT | A0A2K1JLZ3 | Chlorophyll a-b binding | n/a | |
25 | A0A2P6TZ50_LUT | A0A2P6TZ50 | Chlorophyll a-b binding | n/a | |
26 | A0A2P6TDA6_LUT | A0A2P6TDA6 | Chlorophyll a-b binding | n/a | |
27 | A0A2P6U5M3_LUT | A0A2P6U5M3 | Multifunctional fusion protein | n/a | |
28 | A9RT62_LUT | A9RT62 | Chlorophyll a-b binding | n/a | |
29 | A8JF10_LUT | A8JF10 | deleted | n/a | |
30 | A0A6I8WFT9_LUT | A0A6I8WFT9 | Chlorophyll a-b binding | n/a | |
31 | Q41038_LUT | Q41038 | Chlorophyll a-b binding | n/a | |
32 | C1K003_LUT | C1K003 | Chlorophyll a-b binding | n/a | |
33 | G4WUW1_LUT | G4WUW1 | Chlorophyll a-b binding | n/a | |
34 | P0CJ48_LUT | P0CJ48 | Chlorophyll a-b binding | n/a | |
35 | F2D0D5_LUT | F2D0D5 | Chlorophyll a-b binding | n/a | |
36 | Q55274_LUT | Q55274 | Iron stress-induced chlorophyll-binding | n/a | |
37 | A9TJ06_LUT | A9TJ06 | Chlorophyll a-b binding | n/a | |
38 | P12154_LUT | P12154 | Photosystem I P700 | n/a | |
39 | A0A2K1KU97_LUT | A0A2K1KU97 | Chlorophyll a-b binding | n/a | |
40 | B6T1H1_LUT | B6T1H1 | Chlorophyll a-b binding | n/a | |
41 | Q43485_LUT | Q43485 | Chlorophyll a-b binding | n/a | |
42 | A0A287WC32_LUT | A0A287WC32 | deleted | n/a | |
43 | Q07473_LUT | Q07473 | Chlorophyll a-b binding | n/a | |
44 | Q9C639_LUT | Q9C639 | Photosystem I chlorophyll | n/a | |
45 | B3WFZ6_LUT | B3WFZ6 | Chlorophyll a-b binding | n/a | |
46 | Q9SYW8_LUT | Q9SYW8 | Photosystem I chlorophyll | n/a | |
47 | A0A2P6TS63_LUT | A0A2P6TS63 | Chlorophyll a-b binding | n/a | |
48 | A0A2K1K0C7_LUT | A0A2K1K0C7 | Chlorophyll a-b binding | n/a | |
49 | A0A2K1KN29_LUT | A0A2K1KN29 | Chlorophyll a-b binding | n/a | |
50 | C1K004_LUT | C1K004 | Chlorophyll a-b binding | n/a | |
51 | Q9SHE8_LUT | Q9SHE8 | Photosystem I reaction | n/a | |
52 | Q9SY97_LUT | Q9SY97 | Photosystem I chlorophyll | n/a | |
53 | A0A2P6TMT4_LUT | A0A2P6TMT4 | Glutathione reductase | n/a | |
54 | P12329_LUT | P12329 | Chlorophyll a-b binding | n/a | |
55 | Q75VY8_LUT | Q75VY8 | Chlorophyll a-b binding | n/a | |
56 | Q40771_LUT | Q40771 | Chlorophyll a-b binding | n/a | |
57 | B6SRI3_LUT | B6SRI3 | Photosystem I reaction | n/a | |
58 | A0A2P6TT36_LUT | A0A2P6TT36 | Chlorophyll a-b binding | n/a | |
59 | A0A2K1KKR9_LUT | A0A2K1KKR9 | Chlorophyll a-b binding | n/a | |
60 | A0A2K1IW94_LUT | A0A2K1IW94 | Chlorophyll a-b binding | n/a | |
61 | A0A2P6TQ14_LUT | A0A2P6TQ14 | Chlorophyll a-b binding | n/a | |
62 | Q75VY6_LUT | Q75VY6 | Chlorophyll a-b binding | n/a | |
63 | Q93WL4_LUT | Q93WL4 | Chlorophyll a-b binding | n/a | |
64 | F2CW18_LUT | F2CW18 | Chlorophyll a-b binding | n/a | |
65 | A9NKX0_LUT | A9NKX0 | Chlorophyll a-b binding | n/a | |
66 | A0A2P6U4K1_LUT | A0A2P6U4K1 | Chlorophyll a-b binding | n/a | |
67 | P09144_LUT | P09144 | Photosystem I P700 | n/a | |
68 | P04778_LUT | P04778 | Chlorophyll a-b binding | n/a | |
69 | A0A2K1IB10_LUT | A0A2K1IB10 | Chlorophyll a-b binding | n/a | |
70 | Q8S567_LUT | Q8S567 | Chlorophyll a-b binding | n/a | |
71 | Q05093_LUT | Q05093 | Chlorophyll a-b binding | n/a | |
72 | P12356_LUT | P12356 | Photosystem I reaction | n/a | |
73 | A0A6I8WFU0_LUT | A0A6I8WFU0 | Chlorophyll a-b binding | n/a | |
74 | Q01667_LUT | Q01667 | Chlorophyll a-b binding | n/a | |
75 | F2DAN8_LUT | F2DAN8 | Chlorophyll a-b binding | n/a | |
76 | A0A2P6TPU9_LUT | A0A2P6TPU9 | Serine incorporator | n/a | |
77 | Q9FEK6_LUT | Q9FEK6 | Chlorophyll a-b binding | n/a | |
78 | Q9SHR7_LUT | Q9SHR7 | Chlorophyll a-b binding | n/a | |
79 | Q7DM26_LUT | Q7DM26 | Chlorophyll a-b binding | n/a | |
80 | Q93VE0_LUT | Q93VE0 | Chlorophyll a-b binding | n/a | |
81 | A0A2D0TCJ3_LUT | A0A2D0TCJ3 | Chlorophyll a-b binding | n/a | |
82 | Q9ZSJ4_LUT | Q9ZSJ4 | Chlorophyll a-b binding | n/a | |
83 | P59777_LUT | P59777 | Photosystem I reaction | n/a | |
84 | A0A2P6TMI2_LUT | A0A2P6TMI2 | Chlorophyll a-b binding | n/a | |
85 | A8BDJ0_LUT | A8BDJ0 | Chlorophyll a-b binding | n/a | |
86 | Q75VY7_LUT | Q75VY7 | Chlorophyll a-b binding | n/a | |
87 | Q04918_LUT | Q04918 | Chlorophyll a-b binding | n/a | |
88 | Q8LCQ4_LUT | Q8LCQ4 | Photosystem I chlorophyll | n/a | |
89 | A9TEM8_LUT | A9TEM8 | deleted | n/a | |
90 | A9T399_LUT | A9T399 | deleted | n/a | |
91 | Q75VY4_LUT | Q75VY4 | Chlorophyll a-b binding | n/a | |
92 | A0A2D0TCJ1_LUT | A0A2D0TCJ1 | Chlorophyll a-b binding | n/a | |
93 | P17227_LUT | P17227 | Photosystem I reaction | n/a | |
94 | B6SZR1_LUT | B6SZR1 | Chlorophyll a-b binding | n/a | |
95 | P27490_LUT | P27490 | Chlorophyll a-b binding | n/a | |
96 | A0A482JYH1_LUT | A0A482JYH1 | Chlorophyll a-b binding | n/a | |
97 | Q75VZ0_LUT | Q75VZ0 | Chlorophyll a-b binding | n/a | |
98 | P14224_LUT | P14224 | Photosystem I reaction | n/a | |
99 | P12333_LUT | P12333 | Chlorophyll a-b binding | n/a | |
100 | A0A2P6TZI8_LUT | A0A2P6TZI8 | PSI-G | n/a | |
101 | A0A9J4RF17_LUT | A0A9J4RF17 | Chlorophyll a-b binding | n/a | |
102 | Q9XF89_LUT | Q9XF89 | Chlorophyll a-b binding | n/a | |
103 | Q9LKC7_LUT | Q9LKC7 | Chlorophyll a-b binding | n/a | |
104 | A0A2K1K0E4_LUT | A0A2K1K0E4 | Chlorophyll a-b binding | n/a | |
105 | E1C9L2_LUT | E1C9L2 | Chlorophyll a-b binding | n/a | |
106 | Q93WE0_LUT | Q93WE0 | Chlorophyll a-b binding | n/a | |
107 | A8J264_LUT | A8J264 | Chlorophyll a-b binding | n/a | |
108 | A1XKU7_LUT | A1XKU7 | Chlorophyll a-b binding | n/a | |
109 | A9RW10_LUT | A9RW10 | deleted | n/a | |
110 | F2Z293_LUT | F2Z293 | Chlorophyll a-b binding | n/a | |
111 | Q9SDM1_LUT | Q9SDM1 | Chlorophyll a-b binding | n/a |