PDB ligand accession: VIB
DrugBank: DB00152
PubChem:
ChEMBL:
InChI Key: JZRWCGZRTZMZEH-UHFFFAOYSA-N
SMILES: Cc1c(sc[n+]1Cc2cnc(nc2N)C)CCO
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Diazines
- Subclass: Pyrimidines and pyrimidine derivatives
- Class: Diazines
- Superclass: Organoheterocyclic compounds
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | O34664_VIB | O34664 | Thiamine pyrophosphokinase (TPK) | n/a | |
| 2 | P04273_VIB | P04273 | Major prion protein | n/a | |
| 3 | Q49410_VIB | Q49410 | High affinity transport | n/a | |
| 4 | P0DTC1_VIB | P0DTC1 | Replicase polyprotein 1a | n/a | |
| 5 | Q9H3S4_VIB | Q9H3S4 | Thiamine pyrophosphokinase 1 | substrate | |
| 6 | O34738_VIB | O34738 | Putative HMP/thiamine permease | n/a | |
| 7 | O34911_VIB | O34911 | Putative HMP/thiamine-binding protein | n/a | |
| 8 | Q9R0M5_VIB | Q9R0M5 | Thiamine pyrophosphokinase 1 | n/a | |
| 9 | D8KFM5_VIB | D8KFM5 | deleted | n/a | |
| 10 | Q59N99_VIB | Q59N99 | deleted | n/a | |
| 11 | A7FS27_VIB | A7FS27 | deleted | n/a | |
| 12 | Q187U0_VIB | Q187U0 | ABC-type transport system, | n/a | |
| 13 | P35202_VIB | P35202 | Thiamine pyrophosphokinase (TPK) | n/a |