PDB ligand accession: PME
DrugBank: DB00168
PubChem: 134601;6992066;
ChEMBL:
InChI Key: IAOZJIPTCAWIRG-QWRGUYRKSA-N
SMILES: COC(=O)C(Cc1ccccc1)NC(=O)C(CC(=O)O)N
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | B7T1D7_PME | B7T1D7 | Teg12 | n/a | |
2 | Q8NER1_PME | Q8NER1 | Transient receptor potential | inducer | |
3 | Q8TE23_PME | Q8TE23 | Taste receptor type | agonist | |
4 | Q7RTX0_PME | Q7RTX0 | Taste receptor type | n/a | |
5 | P01709_PME | P01709 | Immunoglobulin lambda variable | n/a |