PDB ligand accession: T3
DrugBank: DB00279
PubChem: 5920;7048703;
ChEMBL:
InChI Key: AUYYCJSJGJYCDS-LBPRGKRZSA-N
SMILES: c1cc(c(cc1Oc2c(cc(cc2I)CC(C(=O)O)N)I)I)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P10827_T3 | P10827 | Thyroid hormone receptor | agonist | Ki(nM) = 0.22 IC50(nM) = 0.24 Kd(nM) = 0.058 EC50(nM) = 0.41 |
| 2 | P12004_T3 | P12004 | Proliferating cell nuclear | antagonist | IC50(nM) = 3600.0 |
| 3 | Q9PTT3_T3 | Q9PTT3 | Transthyretin | n/a | |
| 4 | P04625_T3 | P04625 | Thyroid hormone receptor | n/a | |
| 5 | Q6FH41_T3 | Q6FH41 | Thyroid hormone receptor | n/a | |
| 6 | O54983_T3 | O54983 | Ketimine reductase mu-crystallin | n/a | |
| 7 | P10275_T3 | P10275 | Androgen receptor (Dihydrotestosterone | n/a | IC50(nM) = 50000.0 |
| 8 | P10828_T3 | P10828 | Thyroid hormone receptor | agonist | Ki(nM) = 0.08 IC50(nM) = 0.257 Kd(nM) = 0.081 EC50(nM) = 1.1 |