Ligand name: Venlafaxine
PDB ligand accession: n/a
DrugBank: DB00285
InChI Key:
SMILES: COC1=CC=C(C=C1)C(CN(C)C)C1(O)CCCCC1

List of proteins that are targets for DB00285

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P31645_DB00285	P31645	Sodium-dependent serotonin transporter	inhibitor	Ki(nM) = 7.5 IC50(nM) = 20.0 Kd(nM) = 8.9
2	P23975_DB00285	P23975	Sodium-dependent noradrenaline transporter	inhibitor	Ki(nM) = 210.0 IC50(nM) = 149.0 Kd(nM) = 1060.0
3	Q01959_DB00285	Q01959	Sodium-dependent dopamine transporter	inhibitor	Ki(nM) = 3070.0 IC50(nM) = 2550.0 Kd(nM) = 9300.0