PDB ligand accession: D16
DrugBank: DB00293
PubChem: 104758;5281913;135400182;
ChEMBL:
InChI Key: IVTVGDXNLFLDRM-HNNXBMFYSA-N
SMILES: CC1=NC(=O)c2cc(ccc2N1)CN(C)c3ccc(s3)C(=O)NC(CCC(=O)O)C(=O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P04818_D16 | P04818 | Thymidylate synthase (TS) | inhibitor | IC50(nM) = 9.0 |
| 2 | F5HBQ9_D16 | F5HBQ9 | Thymidylate synthase (EC | n/a | |
| 3 | P0A884_D16 | P0A884 | Thymidylate synthase (TS) | n/a | IC50(nM) = 2300.0 |
| 4 | P07607_D16 | P07607 | Thymidylate synthase (TS) | n/a | |
| 5 | Q9Y052_D16 | Q9Y052 | Thymidylate synthase (EC | n/a | |
| 6 | P45352_D16 | P45352 | Thymidylate synthase (TS) | n/a | |
| 7 | A7ASX7_D16 | A7ASX7 | Bifunctional dihydrofolate reductase-thymidylate | n/a | |
| 8 | Q05932_D16 | Q05932 | Folylpolyglutamate synthase, mitochondrial | antagonist | |
| 9 | P67044_D16 | P67044 | Thymidylate synthase (TS) | n/a | |
| 10 | C6GJB8_D16 | C6GJB8 | Thymidylate synthase (EC | n/a | |
| 11 | Q77J90_D16 | Q77J90 | thymidylate synthase (EC | n/a | |
| 12 | Q9WYT0_D16 | Q9WYT0 | Flavin-dependent thymidylate synthase | n/a |