Ligand name: 6-ethoxy-1,3-benzothiazole-2-sulfonamide
PDB ligand accession: EZL
DrugBank: DB00311
PubChem: 3295
ChEMBL: CHEMBL18
InChI Key: OUZWUKMCLIBBOG-UHFFFAOYSA-N
SMILES: CCOc1ccc2c(c1)sc(n2)S(=O)(=O)N

ClassyFire chemical classification:

List of proteins that are targets for DB00311

# DrugDomain Data UniProt Accession Protein name Drug Action Affinity data
1 A0A0M3KL20_EZL A0A0M3KL20 carbonic anhydrase (EC n/a
2 Q3JRA0_EZL Q3JRA0 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase n/a
3 P43166_EZL P43166 Carbonic anhydrase 7 inhibitor Ki(nM) = 0.78
Kd(nM) = 0.71
4 P22748_EZL P22748 Carbonic anhydrase 4 inhibitor Ki(nM) = 93.0
5 P00915_EZL P00915 Carbonic anhydrase 1 inhibitor Ki(nM) = 25.0
IC50(nM) = 8.0
Kd(nM) = 14.0
6 P07451_EZL P07451 Carbonic anhydrase 3 inhibitor Ki(nM) = 5000.0
7 P00918_EZL P00918 Carbonic anhydrase 2 inhibitor Ki(nM) = 0.49
IC50(nM) = 0.3
Kd(nM) = 0.71