Ligand name: Hydromorphone
PDB ligand accession: n/a
DrugBank: DB00327
InChI Key:
SMILES: [H][C@@]12OC3=C(O)C=CC4=C3[C@@]11CCN(C)[C@]([H])(C4)[C@]1([H])CCC2=O

List of proteins that are targets for DB00327

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P41145_DB00327	P41145	Kappa-type opioid receptor	agonist	Ki(nM) = 2.8 EC50(nM) = 11.0
2	P41143_DB00327	P41143	Delta-type opioid receptor	partial agonist	Ki(nM) = 38.0
3	P35372_DB00327	P35372	Mu-type opioid receptor	agonist	Ki(nM) = 0.28 EC50(nM) = 2.6