PDB ligand accession: IMN
DrugBank: DB00328
PubChem:
ChEMBL:
InChI Key: CGIGDMFJXJATDK-UHFFFAOYSA-N
SMILES: Cc1c(c2cc(ccc2n1C(=O)c3ccc(cc3)Cl)OC)CC(=O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Indoles and derivatives
- Subclass: Benzoylindoles
- Class: Indoles and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Drug Action | Affinity data |
---|---|---|---|---|
1 | Q8N8N7_IMN | Q8N8N7 | inhibitor | |
2 | Q9N0A4_IMN | Q9N0A4 | n/a | |
3 | P35354_IMN | P35354 | inhibitor | Ki(nM) = 130.0 IC50(nM) = 0.14 Kd(nM) = 92.0 |
4 | Q04760_IMN | Q04760 | inhibitor | Ki(nM) = 18100.0 |
5 | Q9EQZ5_IMN | Q9EQZ5 | n/a | |
6 | P02768_IMN | P02768 | n/a | Ki(nM) = 15100.0 Kd(nM) = 700.0 |
7 | Q9Y5Y4_IMN | Q9Y5Y4 | other/unknown | Ki(nM) = 50.0 EC50(nM) = 389.0 |
8 | P37231_IMN | P37231 | activator | EC50(nM) = 50000.0 |
9 | P05543_IMN | P05543 | n/a | |
10 | Q05769_IMN | Q05769 | n/a | IC50(nM) = 6.4 |
11 | P24627_IMN | P24627 | n/a | |
12 | P05413_IMN | P05413 | n/a | |
13 | P52895_IMN | P52895 | n/a | Ki(nM) = 100000.0 IC50(nM) = 8970.0 |
14 | P59071_IMN | P59071 | n/a | |
15 | P42330_IMN | P42330 | inhibitor | Ki(nM) = 270.0 IC50(nM) = 100.0 |
16 | P23219_IMN | P23219 | inhibitor | Ki(nM) = 13.0 IC50(nM) = 0.14 Kd(nM) = 253.0 |
17 | P02766_IMN | P02766 | n/a | |
18 | Q07869_IMN | Q07869 | agonist | |
19 | P14555_IMN | P14555 | inhibitor | |
20 | P19525_IMN | P19525 | inducer | |
21 | D0VX11_IMN | D0VX11 | n/a |