PDB ligand accession: H4B
DrugBank: DB00360
PubChem: 44257;5282445;135398654;
ChEMBL:
InChI Key: FNKQXYHWGSIFBK-RPDRRWSUSA-N
SMILES: CC(C(C1CNC2=C(N1)C(=O)NC(=N2)N)O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Pteridines and derivatives
- Subclass: Pterins and derivatives
- Class: Pteridines and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P00439_H4B | P00439 | Phenylalanine-4-hydroxylase (PAH) (EC | cofactor | |
2 | P29474_H4B | P29474 | Nitric oxide synthase | cofactor | |
3 | P29475_H4B | P29475 | Nitric oxide synthase | n/a | |
4 | P17752_H4B | P17752 | Tryptophan 5-hydroxylase 1 | cofactor | |
5 | O34453_H4B | O34453 | Nitric oxide synthase | n/a | |
6 | P07101_H4B | P07101 | Tyrosine 3-monooxygenase (EC | cofactor | |
7 | A0S0A6_H4B | A0S0A6 | Nitric oxide synthase | n/a | |
8 | F1MY54_H4B | F1MY54 | Nitric oxide synthase | n/a | |
9 | P35228_H4B | P35228 | Nitric oxide synthase, | n/a | |
10 | O58368_H4B | O58368 | Uncharacterized protein | n/a | |
11 | P29476_H4B | P29476 | Nitric oxide synthase | n/a | |
12 | Q01782_H4B | Q01782 | Pteridine reductase 1 | n/a | |
13 | P29477_H4B | P29477 | Nitric oxide synthase, | n/a | |
14 | P29473_H4B | P29473 | Nitric oxide synthase | n/a |