PDB ligand accession: ZOL
DrugBank: DB00399
PubChem:
ChEMBL:
InChI Key: XRASPMIURGNCCH-UHFFFAOYSA-N
SMILES: c1cn(cn1)CC(O)(P(=O)(O)O)P(=O)(O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Organic phosphonic acids and derivatives
- Subclass: Bisphosphonates
- Class: Organic phosphonic acids and derivatives
- Superclass: Organic acids and derivatives
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P14324_ZOL | P14324 | Farnesyl pyrophosphate synthase | inhibitor | Ki(nM) = 0.07 IC50(nM) = 0.24 |
2 | O95749_ZOL | O95749 | Geranylgeranyl pyrophosphate synthase | inhibitor | Ki(nM) = 2700.0 IC50(nM) = 5000.0 |
3 | A5K4U6_ZOL | A5K4U6 | Farnesyl pyrophosphate synthase, | n/a | |
4 | Q5CR09_ZOL | Q5CR09 | Putative farnesyl pyrophosphate | n/a | |
5 | M1JS91_ZOL | M1JS91 | Farnesyl pyrophosphate synthase | n/a | |
6 | Q95WL3_ZOL | Q95WL3 | Farnesyl pyrophosphate synthase | n/a | |
7 | Q12051_ZOL | Q12051 | Geranylgeranyl pyrophosphate synthase | n/a | Ki(nM) = 260.0 IC50(nM) = 660.0 |