Ligand name: Remoxipride
PDB ligand accession: n/a
DrugBank: DB00409
InChI Key:
SMILES: CCN1CCC[C@H]1CNC(=O)C1=C(OC)C=CC(Br)=C1OC

List of proteins that are targets for DB00409

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	Q99720_DB00409	Q99720	Sigma non-opioid intracellular	antagonist	Ki(nM) = 55.0
2	P14416_DB00409	P14416	D(2) dopamine receptor	antagonist	Ki(nM) = 16.0 IC50(nM) = 1.2
3	P21917_DB00409	P21917	D(4) dopamine receptor	antagonist	Ki(nM) = 1000.0 IC50(nM) = 3872.0
4	P35462_DB00409	P35462	D(3) dopamine receptor	antagonist	Ki(nM) = 70.0
5	P28223_DB00409	P28223	5-hydroxytryptamine receptor 2A	other/unknown	Ki(nM) = 3100.0