Ligand name: Methylphenidate
PDB ligand accession: n/a
DrugBank: DB00422
InChI Key:
SMILES: COC(=O)C(C1CCCCN1)C1=CC=CC=C1

List of proteins that are targets for DB00422

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P23975_DB00422	P23975	Sodium-dependent noradrenaline transporter	inhibitor	Ki(nM) = 340.0 IC50(nM) = 61.0
2	P08908_DB00422	P08908	5-hydroxytryptamine receptor 1A	n/a
3	Q01959_DB00422	Q01959	Sodium-dependent dopamine transporter	inhibitor	Ki(nM) = 34.0 IC50(nM) = 17.0