Ligand name: Ketorolac
PDB ligand accession: n/a
DrugBank: DB00465
InChI Key:
SMILES: OC(=O)C1CCN2C1=CC=C2C(=O)C1=CC=CC=C1

List of proteins that are targets for DB00465

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P35354_DB00465	P35354	Prostaglandin G/H synthase	inhibitor	Ki(nM) = 75.0 IC50(nM) = 120.0
2	P23219_DB00465	P23219	Prostaglandin G/H synthase	inhibitor	Ki(nM) = 0.19 IC50(nM) = 1230.0