Ligand name: Fluoxetine
PDB ligand accession: n/a
DrugBank: DB00472
InChI Key:
SMILES: CNCCC(OC1=CC=C(C=C1)C(F)(F)F)C1=CC=CC=C1

List of proteins that are targets for DB00472

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P31645_DB00472	P31645	Sodium-dependent serotonin transporter	inhibitor	Ki(nM) = 0.72 IC50(nM) = 2.5 Kd(nM) = 0.81 EC50(nM) = 2.7
2	P32297_DB00472	P32297	Neuronal acetylcholine receptor	antagonist
3	Q12809_DB00472	Q12809	Voltage-gated inwardly rectifying	inhibitor	IC50(nM) = 457.09
4	P28335_DB00472	P28335	5-hydroxytryptamine receptor 2C	antagonist	Ki(nM) = 72.0 IC50(nM) = 160.0
5	P30926_DB00472	P30926	Neuronal acetylcholine receptor	antagonist
6	Q15822_DB00472	Q15822	Neuronal acetylcholine receptor	antagonist