Ligand name: 3-(2-chloro-10H-phenothiazin-10-yl)-N,N-dimethylpropan-1-amine
PDB ligand accession: Z80
DrugBank: DB00477
PubChem: 2726
ChEMBL: CHEMBL71
InChI Key: ZPEIMTDSQAKGNT-UHFFFAOYSA-N
SMILES: CN(C)CCCN1c2ccccc2Sc3c1cc(cc3)Cl

ClassyFire chemical classification:

List of proteins that are targets for DB00477

# DrugDomain Data UniProt Accession Drug Action Affinity data
1 P35368_Z80 P35368 inhibitor
2 P21918_Z80 P21918 inhibitor Ki(nM) = 133.0
3 P02638_Z80 P02638 n/a
4 P11229_Z80 P11229 antagonist Ki(nM) = 25.0
5 P50406_Z80 P50406 binder Ki(nM) = 4.0
6 Q9H3N8_Z80 Q9H3N8 binder Ki(nM) = 50.2
7 P22535_Z80 P22535 n/a
8 P19652_Z80 P19652 binder
9 P21728_Z80 P21728 inhibitor Ki(nM) = 44.0
10 P0DP23_Z80 P0DP23 inhibitor Ki(nM) = 19280.0
IC50(nM) = 7260.0
11 P28223_Z80 P28223 antagonist Ki(nM) = 1.8
12 P35348_Z80 P35348 antagonist Ki(nM) = 0.28
13 Q9VWX8_Z80 Q9VWX8 n/a
14 P14416_Z80 P14416 antagonist Ki(nM) = 0.66
IC50(nM) = 1.0
15 P35367_Z80 P35367 antagonist Ki(nM) = 3.0
IC50(nM) = 12.0
16 P34969_Z80 P34969 binder Ki(nM) = 11.0
17 P08908_Z80 P08908 antagonist Ki(nM) = 116.4
18 P35462_Z80 P35462 inhibitor Ki(nM) = 0.84
19 P17405_Z80 P17405 inhibitor IC50(nM) = 11000.0
20 P04925_Z80 P04925 n/a EC50(nM) = 2000.0
21 P02754_Z80 P02754 n/a
22 P21917_Z80 P21917 binder Ki(nM) = 1.15
23 P28335_Z80 P28335 binder Ki(nM) = 1.4
24 E0SJQ4_Z80 E0SJQ4 n/a
25 P20309_Z80 P20309 antagonist Ki(nM) = 47.0
26 Q12809_Z80 Q12809 inhibitor IC50(nM) = 1470.0