PDB ligand accession: 9CR
DrugBank: DB00523
PubChem:
ChEMBL:
InChI Key: SHGAZHPCJJPHSC-ZVCIMWCZSA-N
SMILES: CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC(=O)O)C)C
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Prenol lipids
- Subclass: Retinoids
- Class: Prenol lipids
- Superclass: Lipids and lipid-like molecules
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P22605_9CR | P22605 | Retinoic acid receptor | n/a | Kd(nM) = 7.0 |
| 2 | P13631_9CR | P13631 | Retinoic acid receptor | agonist | Ki(nM) = 1.0 IC50(nM) = 17.0 Kd(nM) = 0.8 EC50(nM) = 4.0 |
| 3 | P10826_9CR | P10826 | Retinoic acid receptor | agonist | Ki(nM) = 0.5 IC50(nM) = 7.0 Kd(nM) = 0.2 EC50(nM) = 0.8 |
| 4 | P22932_9CR | P22932 | Retinoic acid receptor | n/a | |
| 5 | Q8T5C6_9CR | Q8T5C6 | Retinoic acid receptor | n/a | |
| 6 | P48443_9CR | P48443 | Retinoic acid receptor | agonist | Ki(nM) = 11.0 IC50(nM) = 4.0 Kd(nM) = 14.0 EC50(nM) = 4.3 |
| 7 | P10632_9CR | P10632 | Cytochrome P450 2C8 | n/a | |
| 8 | P28700_9CR | P28700 | Retinoic acid receptor | n/a | IC50(nM) = 82.0 Kd(nM) = 32.0 EC50(nM) = 200.0 |
| 9 | P02766_9CR | P02766 | Transthyretin (ATTR) (Prealbumin) | n/a | |
| 10 | Q15238_9CR | Q15238 | Pregnancy-specific beta-1-glycoprotein 5 | n/a | |
| 11 | P10276_9CR | P10276 | Retinoic acid receptor | agonist | Ki(nM) = 22.0 IC50(nM) = 7.0 Kd(nM) = 0.3 EC50(nM) = 1.0 |
| 12 | P06911_9CR | P06911 | Epididymal-specific lipocalin-5 (Androgen-dependent | n/a | |
| 13 | P19793_9CR | P19793 | Retinoic acid receptor | agonist | Ki(nM) = 8.0 IC50(nM) = 29.0 Kd(nM) = 1.5 EC50(nM) = 1.5 |
| 14 | Q6V0L0_9CR | Q6V0L0 | Cytochrome P450 26C1 | n/a | |
| 15 | P28702_9CR | P28702 | Retinoic acid receptor | agonist | Ki(nM) = 3.8 IC50(nM) = 12.0 Kd(nM) = 11.0 EC50(nM) = 2.6 |