PDB ligand accession: CPF
DrugBank: DB00537
PubChem: 2764;4011971;
ChEMBL:
InChI Key: MYSWGUAQZAJSOK-UHFFFAOYSA-N
SMILES: c1c2c(cc(c1F)N3CCNCC3)N(C=C(C2=O)C(=O)O)C4CC4
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Quinolines and derivatives
- Subclass: Quinoline carboxylic acids
- Class: Quinolines and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P11388_CPF | P11388 | DNA topoisomerase 2-alpha | inhibitor | IC50(nM) = 100000.0 EC50(nM) = 30.0 |
2 | Q12809_CPF | Q12809 | Voltage-gated inwardly rectifying | n/a | Ki(nM) = 100000.0 IC50(nM) = 30000.0 |
3 | P9WG45_CPF | P9WG45 | DNA gyrase subunit | n/a | IC50(nM) = 10600.0 |
4 | P9WG47_CPF | P9WG47 | DNA gyrase subunit | n/a | IC50(nM) = 10000.0 |
5 | P31224_CPF | P31224 | Multidrug efflux pump | n/a | |
6 | P08519_CPF | P08519 | Apolipoprotein(a) (Apo(a)) (Lp(a)) | n/a | |
7 | A0A1C9A1J1_CPF | A0A1C9A1J1 | CmeB | n/a | |
8 | P37432_CPF | P37432 | Outer membrane porin | n/a | |
9 | P66937_CPF | P66937 | DNA gyrase subunit | n/a |