Ligand name: Piroxicam
PDB ligand accession: n/a
DrugBank: DB00554
InChI Key:
SMILES: CN1C(C(=O)NC2=NC=CC=C2)=C(O)C2=C(C=CC=C2)S1(=O)=O

List of proteins that are targets for DB00554

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P23219_DB00554	P23219	Prostaglandin G/H synthase	inhibitor	Ki(nM) = 760.0 IC50(nM) = 1300.0
2	P35354_DB00554	P35354	Prostaglandin G/H synthase	inhibitor	Ki(nM) = 170.0 IC50(nM) = 102000.0