Ligand name: Propranolol
PDB ligand accession: n/a
DrugBank: DB00571
InChI Key:
SMILES: CC(C)NCC(O)COC1=CC=CC2=C1C=CC=C2

List of proteins that are targets for DB00571

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P13945_DB00571	P13945	Beta-3 adrenergic receptor	antagonist	Ki(nM) = 186.0 Kd(nM) = 117.0
2	P28222_DB00571	P28222	5-hydroxytryptamine receptor 1B	other/unknown	Ki(nM) = 56.23 IC50(nM) = 5012.0 EC50(nM) = 5012.0
3	P07550_DB00571	P07550	Beta-2 adrenergic receptor	antagonist	Ki(nM) = 0.01 IC50(nM) = 0.48 Kd(nM) = 0.1
4	P08908_DB00571	P08908	5-hydroxytryptamine receptor 1A	other/unknown	Ki(nM) = 31.0 IC50(nM) = 3981.0
5	P08588_DB00571	P08588	Beta-1 adrenergic receptor	antagonist	Ki(nM) = 0.02 IC50(nM) = 4.0 Kd(nM) = 1.8