Ligand name: Fluticasone propionate
PDB ligand accession: n/a
DrugBank: DB00588
InChI Key:
SMILES: [H][C@@]12C[C@@H](C)[C@](OC(=O)CC)(C(=O)SCF)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])C[C@H](F)C2=CC(=O)C=C[C@]12C

List of proteins that are targets for DB00588

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P06401_DB00588	P06401	Progesterone receptor (PR)	agonist	IC50(nM) = 21.0
2	P47712_DB00588	P47712	Cytosolic phospholipase A2	inhibitor
3	P04150_DB00588	P04150	Glucocorticoid receptor (GR)	agonist	Ki(nM) = 0.238 IC50(nM) = 0.04 EC50(nM) = 0.7
4	P08235_DB00588	P08235	Mineralocorticoid receptor (MR)	antagonist	IC50(nM) = 149.0