PDB ligand accession: n/a
DrugBank: DB00605
InChI Key:
SMILES: CC1=C(CC(O)=O)C2=CC(F)=CC=C2\C1=C/C1=CC=C(C=C1)S(C)=O
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | Q9Y5Y4_DB00605 | Q9Y5Y4 | Prostaglandin D2 receptor | antagonist | |
| 2 | P23219_DB00605 | P23219 | Prostaglandin G/H synthase | inhibitor | |
| 3 | O60218_DB00605 | O60218 | Aldo-keto reductase family | inhibitor | IC50(nM) = 2690.0 |
| 4 | P27361_DB00605 | P27361 | Mitogen-activated protein kinase | inhibitor | |
| 5 | Q03181_DB00605 | Q03181 | Peroxisome proliferator-activated receptor | negative modulator | |
| 6 | P35354_DB00605 | P35354 | Prostaglandin G/H synthase | inhibitor | |
| 7 | P15121_DB00605 | P15121 | Aldo-keto reductase family | inhibitor |