PDB ligand accession: n/a
DrugBank: DB00608
InChI Key: WHTVZRBIWZFKQO-CQSZACIVSA-N
SMILES: CCN(CC)CCCC(C)Nc1ccnc2c1ccc(c2)Cl
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Quinolines and derivatives
- Subclass: Aminoquinolines and derivatives
- Class: Quinolines and derivatives
- Superclass: Organoheterocyclic compounds
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | Q9NR96_DB00608 | Q9NR96 | Toll-like receptor 9 | inhibitor | |
| 2 | P09210_DB00608 | P09210 | Glutathione S-transferase A2 | inhibitor | |
| 3 | P01375_DB00608 | P01375 | Tumor necrosis factor | inhibitor | |
| 4 | Q9BYF1_DB00608 | Q9BYF1 | Angiotensin-converting enzyme 2 | modulator | IC50(nM) = 1130.0 EC50(nM) = 8800.0 |
| 5 | P09488_DB00608 | P09488 | Glutathione S-transferase Mu | inhibitor |