Ligand name: Butorphanol
PDB ligand accession: n/a
DrugBank: DB00611
InChI Key:
SMILES: [H][C@@]12CC3=C(C=C(O)C=C3)[C@]3(CCCC[C@@]13O)CCN2CC1CCC1

List of proteins that are targets for DB00611

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P35372_DB00611	P35372	Mu-type opioid receptor	antagonist	Ki(nM) = 0.12 IC50(nM) = 14.0 EC50(nM) = 3.3
2	P41145_DB00611	P41145	Kappa-type opioid receptor	agonist	Ki(nM) = 0.12 EC50(nM) = 2.9
3	P41143_DB00611	P41143	Delta-type opioid receptor	agonist	Ki(nM) = 12.0