PDB ligand accession: STI
DrugBank: DB00619
PubChem:
ChEMBL:
InChI Key: KTUFNOKKBVMGRW-UHFFFAOYSA-N
SMILES: Cc1ccc(cc1Nc2nccc(n2)c3cccnc3)NC(=O)c4ccc(cc4)CN5CCN(CC5)C
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Anilides
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P43405_STI | P43405 | Tyrosine-protein kinase SYK | n/a | Ki(nM) = 5000.0 IC50(nM) = 5000.0 Kd(nM) = 10000.0 |
2 | P09619_STI | P09619 | Platelet-derived growth factor | antagonist | Ki(nM) = 3.0 IC50(nM) = 50.0 Kd(nM) = 14.0 |
3 | P42684_STI | P42684 | Tyrosine-protein kinase ABL2 | n/a | IC50(nM) = 272.0 Kd(nM) = 10.0 |
4 | P07333_STI | P07333 | Macrophage colony-stimulating factor | antagonist | IC50(nM) = 291.0 Kd(nM) = 10.0 |
5 | P27707_STI | P27707 | Deoxycytidine kinase (dCK) | n/a | |
6 | P16234_STI | P16234 | Platelet-derived growth factor | antagonist | Ki(nM) = 2.0 IC50(nM) = 2.0 Kd(nM) = 31.0 EC50(nM) = 90.0 |
7 | P00519_STI | P00519 | Tyrosine-protein kinase ABL1 | inhibitor | Ki(nM) = 13.0 IC50(nM) = 1.1 Kd(nM) = 1.0 EC50(nM) = 34.0 |
8 | P16083_STI | P16083 | Ribosyldihydronicotinamide dehydrogenase [quinone] | n/a | Ki(nM) = 39.0 IC50(nM) = 43.0 |
9 | Q9UNQ0_STI | Q9UNQ0 | Broad substrate specificity | n/a | IC50(nM) = 500.0 |
10 | P00523_STI | P00523 | Proto-oncogene tyrosine-protein kinase | n/a | IC50(nM) = 2784.0 |
11 | P11274_STI | P11274 | Breakpoint cluster region | inhibitor | |
12 | Q16832_STI | Q16832 | Discoidin domain-containing receptor | antagonist | IC50(nM) = 141.0 Kd(nM) = 15.0 |
13 | P37231_STI | P37231 | Peroxisome proliferator-activated receptor | n/a | |
14 | P04629_STI | P04629 | High affinity nerve | antagonist | Kd(nM) = 10000.0 |
15 | Q08345_STI | Q08345 | Epithelial discoidin domain-containing | antagonist | IC50(nM) = 43.0 Kd(nM) = 0.7 |
16 | P06239_STI | P06239 | Tyrosine-protein kinase Lck | n/a | Ki(nM) = 6893.0 IC50(nM) = 160.0 Kd(nM) = 40.0 |
17 | Q16539_STI | Q16539 | Mitogen-activated protein kinase | n/a | IC50(nM) = 13700.0 Kd(nM) = 3162.0 |
18 | Q59FK4_STI | Q59FK4 | Tyrosine-protein kinase (EC | n/a | |
19 | P00520_STI | P00520 | Tyrosine-protein kinase ABL1 | n/a | IC50(nM) = 10.8 |
20 | P10721_STI | P10721 | Mast/stem cell growth | antagonist | Ki(nM) = 14.0 IC50(nM) = 16.0 Kd(nM) = 3.0 EC50(nM) = 100.0 |