PDB ligand accession: LYA
DrugBank: DB00642
PubChem: 446556;5288715;135410875;
ChEMBL:
InChI Key: WBXPDJSOTKVWSJ-ZDUSSCGKSA-N
SMILES: c1cc(ccc1CCc2c[nH]c3c2C(=O)N=C(N3)N)C(=O)NC(CCC(=O)O)C(=O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P14207_LYA | P14207 | Folate receptor beta | n/a | |
2 | P67044_LYA | P67044 | Thymidylate synthase (TS) | n/a | |
3 | P41440_LYA | P41440 | Reduced folate transporter | n/a | |
4 | Q94C74_LYA | Q94C74 | Serine hydroxymethyltransferase 2, | n/a | |
5 | P04818_LYA | P04818 | Thymidylate synthase (TS) | inhibitor | |
6 | A7ASX7_LYA | A7ASX7 | Bifunctional dihydrofolate reductase-thymidylate | n/a | |
7 | P00374_LYA | P00374 | Dihydrofolate reductase (EC | inhibitor | |
8 | O76290_LYA | O76290 | Pteridine reductase | n/a | |
9 | P9WNX1_LYA | P9WNX1 | Dihydrofolate reductase (EC | n/a | |
10 | P22102_LYA | P22102 | Trifunctional purine biosynthetic | inhibitor | |
11 | P31939_LYA | P31939 | Bifunctional purine biosynthesis | inhibitor |