Ligand name: Trazodone
PDB ligand accession: n/a
DrugBank: DB00656
InChI Key:
SMILES: ClC1=CC=CC(=C1)N1CCN(CCCN2N=C3C=CC=CN3C2=O)CC1

List of proteins that are targets for DB00656

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P28335_DB00656	P28335	5-hydroxytryptamine receptor 2C	agonist	Ki(nM) = 25.0
2	P35367_DB00656	P35367	Histamine H1 receptor	antagonist	Ki(nM) = 1100.0
3	P08908_DB00656	P08908	5-hydroxytryptamine receptor 1A	antagonist	Ki(nM) = 96.0 EC50(nM) = 785.0
4	P31645_DB00656	P31645	Sodium-dependent serotonin transporter	inhibitor	Ki(nM) = 160.0
5	P08913_DB00656	P08913	Alpha-2A adrenergic receptor	antagonist	Ki(nM) = 106.0
6	P35348_DB00656	P35348	Alpha-1A adrenergic receptor	antagonist	Ki(nM) = 12.0
7	P28223_DB00656	P28223	5-hydroxytryptamine receptor 2A	antagonist	Ki(nM) = 44.67 IC50(nM) = 243.0