Ligand name: Sumatriptan
PDB ligand accession: n/a
DrugBank: DB00669
InChI Key:
SMILES: CNS(=O)(=O)CC1=CC=C2NC=C(CCN(C)C)C2=C1

List of proteins that are targets for DB00669

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P08908_DB00669	P08908	5-hydroxytryptamine receptor 1A	agonist	Ki(nM) = 230.0 IC50(nM) = 398.0 Kd(nM) = 3162.0 EC50(nM) = 1000.0
2	P30939_DB00669	P30939	5-hydroxytryptamine receptor 1F	agonist	Ki(nM) = 22.9 IC50(nM) = 1000.0 EC50(nM) = 35.0
3	P28222_DB00669	P28222	5-hydroxytryptamine receptor 1B	agonist	Ki(nM) = 0.5 IC50(nM) = 0.501187 EC50(nM) = 38.0
4	P28221_DB00669	P28221	5-hydroxytryptamine receptor 1D	agonist	Ki(nM) = 0.5 IC50(nM) = 3.0 EC50(nM) = 4.3