Ligand name: Naltrexone
PDB ligand accession: n/a
DrugBank: DB00704
InChI Key:
SMILES: [H][C@@]12OC3=C(O)C=CC4=C3[C@@]11CCN(CC3CC3)[C@]([H])(C4)[C@]1(O)CCC2=O

List of proteins that are targets for DB00704

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P41145_DB00704	P41145	Kappa-type opioid receptor	antagonist	Ki(nM) = 0.042 IC50(nM) = 1.9 EC50(nM) = 0.81
2	P41143_DB00704	P41143	Delta-type opioid receptor	antagonist	Ki(nM) = 6.3 IC50(nM) = 0.55 EC50(nM) = 4.4
3	P35372_DB00704	P35372	Mu-type opioid receptor	antagonist	Ki(nM) = 0.07 IC50(nM) = 0.59 EC50(nM) = 0.38
4	Q99720_DB00704	Q99720	Sigma non-opioid intracellular	n/a