Ligand name: Flurbiprofen
PDB ligand accession: n/a
DrugBank: DB00712
InChI Key:
SMILES: CC(C(O)=O)C1=CC(F)=C(C=C1)C1=CC=CC=C1

List of proteins that are targets for DB00712

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P35354_DB00712	P35354	Prostaglandin G/H synthase	inhibitor	Ki(nM) = 770.0 IC50(nM) = 10.0
2	P23219_DB00712	P23219	Prostaglandin G/H synthase	inhibitor	Ki(nM) = 75.0 IC50(nM) = 10.0