Ligand name: Etodolac
PDB ligand accession: n/a
DrugBank: DB00749
InChI Key:
SMILES: CCC1=C2NC3=C(CCOC3(CC)CC(O)=O)C2=CC=C1

List of proteins that are targets for DB00749

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P19793_DB00749	P19793	Retinoic acid receptor	other
2	P23219_DB00749	P23219	Prostaglandin G/H synthase	inhibitor	Ki(nM) = 1200.0 IC50(nM) = 9.4
3	P35354_DB00749	P35354	Prostaglandin G/H synthase	inhibitor	Ki(nM) = 940.0 IC50(nM) = 9.4