PDB ligand accession: n/a
DrugBank: DB00794
InChI Key: DQMZLTXERSFNPB-UHFFFAOYSA-N
SMILES: CCC1(C(=O)NCNC1=O)c2ccccc2
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Diazines
- Subclass: Pyrimidines and pyrimidine derivatives
- Class: Diazines
- Superclass: Organoheterocyclic compounds
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P48169_DB00794 | P48169 | Gamma-aminobutyric acid receptor | potentiator | |
| 2 | P47869_DB00794 | P47869 | Gamma-aminobutyric acid receptor | potentiator | |
| 3 | P34903_DB00794 | P34903 | Gamma-aminobutyric acid receptor | positive allosteric modulator | |
| 4 | Q16445_DB00794 | Q16445 | Gamma-aminobutyric acid receptor | positive allosteric modulator | |
| 5 | P43681_DB00794 | P43681 | Neuronal acetylcholine receptor | antagonist | |
| 6 | P42262_DB00794 | P42262 | Glutamate receptor 2 | antagonist | |
| 7 | P36544_DB00794 | P36544 | Neuronal acetylcholine receptor | antagonist | |
| 8 | P14867_DB00794 | P14867 | Gamma-aminobutyric acid receptor | potentiator | |
| 9 | P31644_DB00794 | P31644 | Gamma-aminobutyric acid receptor | positive allosteric modulator | |
| 10 | Q13002_DB00794 | Q13002 | Glutamate receptor ionotropic, | antagonist |