Ligand name: Tazarotene
PDB ligand accession: n/a
DrugBank: DB00799
InChI Key:
SMILES: CCOC(=O)C1=CN=C(C=C1)C#CC1=CC2=C(SCCC2(C)C)C=C1

List of proteins that are targets for DB00799

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P13631_DB00799	P13631	Retinoic acid receptor	agonist	EC50(nM) = 40.0
2	P28702_DB00799	P28702	Retinoic acid receptor	agonist
3	P10826_DB00799	P10826	Retinoic acid receptor	agonist	EC50(nM) = 0.8
4	P10276_DB00799	P10276	Retinoic acid receptor	agonist	EC50(nM) = 63.0