Ligand name: 5-ACETAMIDO-1,3,4-THIADIAZOLE-2-SULFONAMIDE
PDB ligand accession: AZM
DrugBank: DB00819
PubChem: 1986
ChEMBL: CHEMBL20
InChI Key: BZKPWHYZMXOIDC-UHFFFAOYSA-N
SMILES: CC(=O)Nc1nnc(s1)S(=O)(=O)N

ClassyFire chemical classification:

• Kingdom: Organic compounds
  • Superclass: Organoheterocyclic compounds
    • Class: Azoles
      • Subclass: Thiadiazoles

List of proteins that are targets for DB00819

#	DrugDomain Data	UniProt Accession	Drug Action	Affinity data
1	Q9ULX7_AZM	Q9ULX7	inhibitor	Ki(nM) = 5.7 IC50(nM) = 48.0 Kd(nM) = 2.1
2	P43166_AZM	P43166	inhibitor	Ki(nM) = 2.0 IC50(nM) = 265.0 Kd(nM) = 2.4
3	E8T502_AZM	E8T502	n/a
4	Q9WVT6_AZM	Q9WVT6	n/a
5	C1DTU5_AZM	C1DTU5	n/a
6	B2V8E3_AZM	B2V8E3	n/a
7	Q8N1Q1_AZM	Q8N1Q1	n/a	Ki(nM) = 5.7 Kd(nM) = 10.0 koff(s-1) = 0.015
8	P29029_AZM	P29029	n/a	Ki(nM) = 21000.0
9	Q81EJ6_AZM	Q81EJ6	n/a
10	Q16790_AZM	Q16790	n/a	Ki(nM) = 0.06 IC50(nM) = 2.6 Kd(nM) = 1.0 koff(s-1) = 0.03
11	Q3JRA0_AZM	Q3JRA0	n/a
12	P23589_AZM	P23589	n/a	Ki(nM) = 58.0
13	Q50940_AZM	Q50940	n/a
14	P00915_AZM	P00915	inhibitor	Ki(nM) = 0.25 IC50(nM) = 0.9957 Kd(nM) = 290.0
15	Q39588_AZM	Q39588	n/a
16	Q96554_AZM	Q96554	n/a
17	O43570_AZM	O43570	inhibitor	Ki(nM) = 2.5 IC50(nM) = 5.7 Kd(nM) = 24.0
18	K4NGD4_AZM	K4NGD4	n/a
19	P00918_AZM	P00918	inhibitor	Ki(nM) = 0.012 IC50(nM) = 0.485 Kd(nM) = 2.6 koff(s-1) = 0.06
20	P22748_AZM	P22748	inhibitor	Ki(nM) = 8.6 IC50(nM) = 17.5 Kd(nM) = 12.0
21	P07451_AZM	P07451	inhibitor	Ki(nM) = 3.1 IC50(nM) = 840.0 Kd(nM) = 4600.0
22	B0Y2Y2_AZM	B0Y2Y2	n/a
23	C0QRB5_AZM	C0QRB5	n/a
24	P29972_AZM	P29972	inhibitor
25	Q4WQ18_AZM	Q4WQ18	n/a