Ligand name: Carprofen
PDB ligand accession: n/a
DrugBank: DB00821
InChI Key:
SMILES: CC(C(O)=O)C1=CC2=C(C=C1)C1=C(N2)C=CC(Cl)=C1

List of proteins that are targets for DB00821

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P23219_DB00821	P23219	Prostaglandin G/H synthase	inhibitor	Ki(nM) = 87.0 IC50(nM) = 5.3
2	P35354_DB00821	P35354	Prostaglandin G/H synthase	inhibitor	Ki(nM) = 4300.0 IC50(nM) = 5.3