Ligand name: Loperamide
PDB ligand accession: n/a
DrugBank: DB00836
InChI Key:
SMILES: CN(C)C(=O)C(CCN1CCC(O)(CC1)C1=CC=C(Cl)C=C1)(C1=CC=CC=C1)C1=CC=CC=C1

List of proteins that are targets for DB00836

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P41145_DB00836	P41145	Kappa-type opioid receptor	agonist	IC50(nM) = 155.0
2	P0DP23_DB00836	P0DP23	Calmodulin-1	inhibitor
3	P41143_DB00836	P41143	Delta-type opioid receptor	agonist	IC50(nM) = 123.0 EC50(nM) = 156.0
4	O00555_DB00836	O00555	Voltage-dependent P/Q-type calcium	blocker
5	Q12809_DB00836	Q12809	Voltage-gated inwardly rectifying	blocker	IC50(nM) = 33.0
6	P35372_DB00836	P35372	Mu-type opioid receptor	agonist	Ki(nM) = 0.268 IC50(nM) = 1.5