Ligand name: Donepezil
PDB ligand accession: n/a
DrugBank: DB00843
InChI Key:
SMILES: COC1=C(OC)C=C2C(=O)C(CC3CCN(CC4=CC=CC=C4)CC3)CC2=C1

List of proteins that are targets for DB00843

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P28223_DB00843	P28223	5-hydroxytryptamine receptor 2A	inducer
2	P06276_DB00843	P06276	Cholinesterase (EC 3.1.1.8)	inducer	Ki(nM) = 640.0 IC50(nM) = 14.0
3	P22303_DB00843	P22303	Acetylcholinesterase (AChE) (EC	inhibitor	Ki(nM) = 2.9 IC50(nM) = 2.0 Kd(nM) = 8.0 EC50(nM) = 43.0
4	P98066_DB00843	P98066	Tumor necrosis factor-inducible	inhibitor
5	P29475_DB00843	P29475	Nitric oxide synthase	inhibitor
6	P01584_DB00843	P01584	Interleukin-1 beta (IL-1	inhibitor