Ligand name: Nalbuphine
PDB ligand accession: n/a
DrugBank: DB00844
InChI Key:
SMILES: O[C@H]1CC[C@@]2(O)[C@H]3CC4=CC=C(O)C5=C4[C@@]2(CCN3CC2CCC2)[C@H]1O5

List of proteins that are targets for DB00844

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P35372_DB00844	P35372	Mu-type opioid receptor	antagonist	Ki(nM) = 0.89 IC50(nM) = 1.0 EC50(nM) = 14.0
2	P41143_DB00844	P41143	Delta-type opioid receptor	antagonist	Ki(nM) = 240.0 IC50(nM) = 353.0
3	P41145_DB00844	P41145	Kappa-type opioid receptor	agonist	Ki(nM) = 2.2 IC50(nM) = 83.0 EC50(nM) = 25.1