Ligand name: Levorphanol
PDB ligand accession: n/a
DrugBank: DB00854
InChI Key:
SMILES: [H][C@@]12CCCC[C@@]11CCN(C)[C@@H]2CC2=C1C=C(O)C=C2

List of proteins that are targets for DB00854

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P41143_DB00854	P41143	Delta-type opioid receptor	agonist	Ki(nM) = 4.2 IC50(nM) = 2.9
2	P41145_DB00854	P41145	Kappa-type opioid receptor	agonist	Ki(nM) = 1.5 IC50(nM) = 4.0
3	P35372_DB00854	P35372	Mu-type opioid receptor	agonist	Ki(nM) = 0.08 IC50(nM) = 0.13