Ligand name: Suprofen
PDB ligand accession: n/a
DrugBank: DB00870
InChI Key:
SMILES: CC(C(O)=O)C1=CC=C(C=C1)C(=O)C1=CC=CS1

List of proteins that are targets for DB00870

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P35354_DB00870	P35354	Prostaglandin G/H synthase	inhibitor	Ki(nM) = 8300.0 IC50(nM) = 2750.0
2	P23219_DB00870	P23219	Prostaglandin G/H synthase	inhibitor	Ki(nM) = 1100.0 IC50(nM) = 560.0