PDB ligand accession: QDN
DrugBank: DB00908
PubChem:
ChEMBL:
InChI Key: LOUPRKONTZGTKE-LHHVKLHASA-N
SMILES: COc1ccc2c(c1)c(ccn2)C(C3CC4CCN3CC4C=C)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Alkaloids and derivatives
- Class: Cinchona alkaloids
- Subclass: None
- Class: Cinchona alkaloids
- Superclass: Alkaloids and derivatives
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P35368_QDN | P35368 | Alpha-1B adrenergic receptor | antagonist | |
| 2 | P10635_QDN | P10635 | Cytochrome P450 2D6 | n/a | Ki(nM) = 9.8 IC50(nM) = 2.0 |
| 3 | O00180_QDN | O00180 | Potassium channel subfamily | inhibitor | |
| 4 | Q12809_QDN | Q12809 | Voltage-gated inwardly rectifying | inhibitor | IC50(nM) = 324.0 |
| 5 | P25100_QDN | P25100 | Alpha-1D adrenergic receptor | antagonist | |
| 6 | Q14524_QDN | Q14524 | Sodium channel protein | inhibitor | |
| 7 | Q9Y257_QDN | Q9Y257 | Potassium channel subfamily | inhibitor | |
| 8 | P35348_QDN | P35348 | Alpha-1A adrenergic receptor | antagonist |