Ligand name: Ketotifen
PDB ligand accession: n/a
DrugBank: DB00920
InChI Key:
SMILES: CN1CCC(CC1)=C1C2=C(SC=C2)C(=O)CC2=CC=CC=C12

List of proteins that are targets for DB00920

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P52209_DB00920	P52209	6-phosphogluconate dehydrogenase, decarboxylating	inhibitor	Ki(nM) = 8300.0 IC50(nM) = 8400.0
2	P35367_DB00920	P35367	Histamine H1 receptor	antagonist	Ki(nM) = 0.158 IC50(nM) = 1.0