Ligand name: Buprenorphine
PDB ligand accession: n/a
DrugBank: DB00921
InChI Key:
SMILES: CO[C@]12CC[C@@]3(C[C@@H]1[C@](C)(O)C(C)(C)C)[C@H]1CC4=C5C(O[C@@H]2[C@@]35CCN1CC1CC1)=C(O)C=C4

List of proteins that are targets for DB00921

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P41145_DB00921	P41145	Kappa-type opioid receptor	antagonist	Ki(nM) = 0.04 IC50(nM) = 1.2 EC50(nM) = 0.18
2	P41146_DB00921	P41146	Nociceptin receptor (Kappa-type	n/a	Ki(nM) = 77.0 EC50(nM) = 116.0
3	P41143_DB00921	P41143	Delta-type opioid receptor	antagonist	Ki(nM) = 2.9 IC50(nM) = 0.9 EC50(nM) = 10000.0
4	P35372_DB00921	P35372	Mu-type opioid receptor	partial agonist	Ki(nM) = 0.21 IC50(nM) = 0.59 EC50(nM) = 0.11