PDB ligand accession: JMS
DrugBank: DB00939
PubChem:
ChEMBL:
InChI Key: SBDNJUWAMKYJOX-UHFFFAOYSA-N
SMILES: Cc1ccc(c(c1Cl)Nc2ccccc2C(=O)O)Cl
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Benzoic acids and derivatives
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | Q04828_JMS | Q04828 | Aldo-keto reductase family | n/a | IC50(nM) = 740.0 |
2 | P09917_JMS | P09917 | Polyunsaturated fatty acid | inhibitor | |
3 | P24627_JMS | P24627 | Lactotransferrin (Lactoferrin) (EC | n/a | |
4 | O43525_JMS | O43525 | Potassium voltage-gated channel | other | |
5 | P35354_JMS | P35354 | Prostaglandin G/H synthase | inhibitor | Ki(nM) = 200.0 IC50(nM) = 40.0 |
6 | P23219_JMS | P23219 | Prostaglandin G/H synthase | inhibitor | Ki(nM) = 220.0 IC50(nM) = 220.0 |
7 | O43526_JMS | O43526 | Potassium voltage-gated channel | other | |
8 | P42330_JMS | P42330 | Aldo-keto reductase family | n/a | IC50(nM) = 512.0 |
9 | Q9C0B1_JMS | Q9C0B1 | Alpha-ketoglutarate-dependent dioxygenase FTO | n/a | IC50(nM) = 7940.0 |