Ligand name: Rizatriptan
PDB ligand accession: n/a
DrugBank: DB00953
InChI Key:
SMILES: CN(C)CCC1=CNC2=C1C=C(CN1C=NC=N1)C=C2

List of proteins that are targets for DB00953

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P30939_DB00953	P30939	5-hydroxytryptamine receptor 1F	agonist
2	P28222_DB00953	P28222	5-hydroxytryptamine receptor 1B	agonist	Ki(nM) = 3.0 IC50(nM) = 41.0
3	P28221_DB00953	P28221	5-hydroxytryptamine receptor 1D	agonist	Ki(nM) = 3.0 IC50(nM) = 11.0 EC50(nM) = 3.0