Ligand name: Pindolol
PDB ligand accession: n/a
DrugBank: DB00960
InChI Key:
SMILES: CC(C)NCC(O)COC1=CC=CC2=C1C=CN2

List of proteins that are targets for DB00960

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P13945_DB00960	P13945	Beta-3 adrenergic receptor	agonist	Ki(nM) = 44.1 Kd(nM) = 166.0
2	P28222_DB00960	P28222	5-hydroxytryptamine receptor 1B	other/unknown	Ki(nM) = 2600.0
3	P08908_DB00960	P08908	5-hydroxytryptamine receptor 1A	antagonist	Ki(nM) = 15.0 EC50(nM) = 27.0
4	P08588_DB00960	P08588	Beta-1 adrenergic receptor	partial agonist	Ki(nM) = 0.52 Kd(nM) = 2.4
5	P07550_DB00960	P07550	Beta-2 adrenergic receptor	partial agonist	Ki(nM) = 0.32 Kd(nM) = 0.537032