Ligand name: Ketoprofen
PDB ligand accession: n/a
DrugBank: DB01009
InChI Key:
SMILES: CC(C(O)=O)C1=CC(=CC=C1)C(=O)C1=CC=CC=C1

List of proteins that are targets for DB01009

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P25024_DB01009	P25024	C-X-C chemokine receptor	other
2	P23219_DB01009	P23219	Prostaglandin G/H synthase	inhibitor	Ki(nM) = 47.0 IC50(nM) = 2.0
3	P35354_DB01009	P35354	Prostaglandin G/H synthase	inhibitor	Ki(nM) = 240.0 IC50(nM) = 26.0