Ligand name: NOVOBIOCIN
PDB ligand accession: NOV
DrugBank: DB01051
PubChem: 54675769
ChEMBL: CHEMBL36506
InChI Key: YJQPYGGHQPGBLI-KGSXXDOSSA-N
SMILES: Cc1c(ccc2c1OC(=O)C(=C2O)NC(=O)c3ccc(c(c3)CC=C(C)C)O)OC4C(C(C(C(O4)(C)C)OC)OC(=O)N)O

ClassyFire chemical classification:

List of proteins that are targets for DB01051

# DrugDomain Data UniProt Accession Protein name Drug Action Affinity data
1 Q9H492_NOV Q9H492 Microtubule-associated protein 1 n/a Ki(nM) = 8800.0
IC50(nM) = 42900.0
Kd(nM) = 7500.0
2 Q9I7C2_NOV Q9I7C2 DNA gyrase subunit n/a
3 A0A009KIJ4_NOV A0A009KIJ4 deleted n/a
4 P0A0K8_NOV P0A0K8 DNA gyrase subunit inhibitor IC50(nM) = 30.0
5 Q9LCX5_NOV Q9LCX5 DNA gyrase subunit n/a
6 P0A9V1_NOV P0A9V1 Lipopolysaccharide export system n/a
7 A0A0H3CR83_NOV A0A0H3CR83 Lipopolysaccharide export system n/a
8 A0A117ILT2_NOV A0A117ILT2 DNA gyrase subunit n/a
9 X5EN43_NOV X5EN43 deleted n/a
10 P20083_NOV P20083 DNA topoisomerase 4 n/a
11 P0C559_NOV P0C559 DNA gyrase subunit n/a IC50(nM) = 46.0
12 P06982_NOV P06982 DNA gyrase subunit n/a
13 Q5GYJ8_NOV Q5GYJ8 DNA topoisomerase 4 n/a