PDB ligand accession: C5U
DrugBank: DB01115
PubChem:
ChEMBL:
InChI Key: HYIMSNHJOBLJNT-UHFFFAOYSA-N
SMILES: CC1=C(C(C(=C(N1)C)C(=O)OC)c2ccccc2N(=O)=O)C(=O)OC
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Pyridines and derivatives
- Subclass: Hydropyridines
- Class: Pyridines and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | Q13936_C5U | Q13936 | Voltage-dependent L-type calcium | inhibitor | IC50(nM) = 10.0 |
2 | Q01668_C5U | Q01668 | Voltage-dependent L-type calcium | inhibitor | |
3 | O75469_C5U | O75469 | Nuclear receptor subfamily | agonist | |
4 | P07293_C5U | P07293 | Voltage-dependent L-type calcium | n/a | |
5 | Q9UK17_C5U | Q9UK17 | A-type voltage-gated potassium | inhibitor | |
6 | Q08289_C5U | Q08289 | Voltage-dependent L-type calcium | inhibitor | |
7 | P0DP23_C5U | P0DP23 | Calmodulin-1 | inhibitor | |
8 | Q13698_C5U | Q13698 | Voltage-dependent L-type calcium | inhibitor |