Ligand name: Nefazodone
PDB ligand accession: n/a
DrugBank: DB01149
InChI Key:
SMILES: CCC1=NN(CCCN2CCN(CC2)C2=CC(Cl)=CC=C2)C(=O)N1CCOC1=CC=CC=C1

List of proteins that are targets for DB01149

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P23975_DB01149	P23975	Sodium-dependent noradrenaline transporter	inhibitor	Ki(nM) = 360.0 Kd(nM) = 360.0
2	P08913_DB01149	P08913	Alpha-2A adrenergic receptor	antagonist	Ki(nM) = 84.0
3	Q12809_DB01149	Q12809	Voltage-gated inwardly rectifying	antagonist
4	P35368_DB01149	P35368	Alpha-1B adrenergic receptor	other/unknown
5	P28335_DB01149	P28335	5-hydroxytryptamine receptor 2C	antagonist	Ki(nM) = 26.0
6	Q01959_DB01149	Q01959	Sodium-dependent dopamine transporter	inhibitor	Ki(nM) = 360.0 Kd(nM) = 360.0
7	P31645_DB01149	P31645	Sodium-dependent serotonin transporter	inhibitor	Ki(nM) = 200.0 Kd(nM) = 200.0
8	P28223_DB01149	P28223	5-hydroxytryptamine receptor 2A	antagonist	Ki(nM) = 5.8
9	P08908_DB01149	P08908	5-hydroxytryptamine receptor 1A	antagonist	Ki(nM) = 80.0
10	P35348_DB01149	P35348	Alpha-1A adrenergic receptor	antagonist	Ki(nM) = 5.5